C9H9Br3O — CID 70578874
1,2,3-tribromo-4-propoxybenzene (PubChem CID 70578874) has the molecular formula C9H9Br3O and a molecular weight of 372.88 g/mol. Its IUPAC name is 1,2,3-tribromo-4-propoxybenzene.
| Compound Name | 1,2,3-tribromo-4-propoxybenzene |
|---|---|
| PubChem CID | 70578874 |
| Molecular Formula | C9H9Br3O |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 369.82 |
| IUPAC Name | 1,2,3-tribromo-4-propoxybenzene |
| SMILES | CCCOc1ccc(Br)c(Br)c1Br |
| InChI | InChI=1S/C9H9Br3O/c1-2-5-13-7-4-3-6(10)8(11)9(7)12/h3-4H,2,5H2,1H3 |
| InChIKey | LXTKOAJDXOYIAM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|