C23H27Br5O2 — CID 67920198
1,2,3-tribromo-4-[2-(2,3-dibromo-4-nonylphenoxy)ethoxy]benzene (PubChem CID 67920198) has the molecular formula C23H27Br5O2 and a molecular weight of 734.99 g/mol. Its IUPAC name is 1,2,3-tribromo-4-[2-(2,3-dibromo-4-nonylphenoxy)ethoxy]benzene.
| Compound Name | 1,2,3-tribromo-4-[2-(2,3-dibromo-4-nonylphenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 67920198 |
| Molecular Formula | C23H27Br5O2 |
| Molecular Weight | 734.99 g/mol |
| Exact Mass | 729.79 |
| IUPAC Name | 1,2,3-tribromo-4-[2-(2,3-dibromo-4-nonylphenoxy)ethoxy]benzene |
| SMILES | CCCCCCCCCc1ccc(OCCOc2ccc(Br)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C23H27Br5O2/c1-2-3-4-5-6-7-8-9-16-10-12-18(22(27)20(16)25)29-14-15-30-19-13-11-17(24)21(26)23(19)28/h10-13H,2-9,14-15H2,1H3 |
| InChIKey | PUPOVEAMGGSQKS-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.99 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|