C19H29Br3O2 — CID 141472485
2-bromo-3-(dibromomethyl)-1,4-dihexoxybenzene (PubChem CID 141472485) has the molecular formula C19H29Br3O2 and a molecular weight of 529.15 g/mol. Its IUPAC name is 2-bromo-3-(dibromomethyl)-1,4-dihexoxybenzene.
| Compound Name | 2-bromo-3-(dibromomethyl)-1,4-dihexoxybenzene |
|---|---|
| PubChem CID | 141472485 |
| Molecular Formula | C19H29Br3O2 |
| Molecular Weight | 529.15 g/mol |
| Exact Mass | 525.97 |
| IUPAC Name | 2-bromo-3-(dibromomethyl)-1,4-dihexoxybenzene |
| SMILES | CCCCCCOc1ccc(OCCCCCC)c(C(Br)Br)c1Br |
| InChI | InChI=1S/C19H29Br3O2/c1-3-5-7-9-13-23-15-11-12-16(18(20)17(15)19(21)22)24-14-10-8-6-4-2/h11-12,19H,3-10,13-14H2,1-2H3 |
| InChIKey | KPSJYZHAMSVBDZ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.15 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|