C14H17Br5O — CID 86095379
1-bromo-2,5-bis(dibromomethyl)-4-hexoxybenzene (PubChem CID 86095379) has the molecular formula C14H17Br5O and a molecular weight of 600.81 g/mol. Its IUPAC name is 1-bromo-2,5-bis(dibromomethyl)-4-hexoxybenzene.
| Compound Name | 1-bromo-2,5-bis(dibromomethyl)-4-hexoxybenzene |
|---|---|
| PubChem CID | 86095379 |
| Molecular Formula | C14H17Br5O |
| Molecular Weight | 600.81 g/mol |
| Exact Mass | 595.72 |
| IUPAC Name | 1-bromo-2,5-bis(dibromomethyl)-4-hexoxybenzene |
| SMILES | CCCCCCOc1cc(C(Br)Br)c(Br)cc1C(Br)Br |
| InChI | InChI=1S/C14H17Br5O/c1-2-3-4-5-6-20-12-8-9(13(16)17)11(15)7-10(12)14(18)19/h7-8,13-14H,2-6H2,1H3 |
| InChIKey | NFPZOFIKCKHKQB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.81 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|