C16H24Br2O2 — CID 63441595
1-bromo-2-(1-bromohexyl)-4,5-diethoxybenzene (PubChem CID 63441595) has the molecular formula C16H24Br2O2 and a molecular weight of 408.17 g/mol. Its IUPAC name is 1-bromo-2-(1-bromohexyl)-4,5-diethoxybenzene.
| Compound Name | 1-bromo-2-(1-bromohexyl)-4,5-diethoxybenzene |
|---|---|
| PubChem CID | 63441595 |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 1-bromo-2-(1-bromohexyl)-4,5-diethoxybenzene |
| SMILES | CCCCCC(Br)c1cc(OCC)c(OCC)cc1Br |
| InChI | InChI=1S/C16H24Br2O2/c1-4-7-8-9-13(17)12-10-15(19-5-2)16(20-6-3)11-14(12)18/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | JBODINUHMXSKSR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|