C12H14Br2F2O2 — CID 103514520
1-bromo-2-(1-bromo-2,2-difluoroethyl)-4,5-diethoxybenzene (PubChem CID 103514520) has the molecular formula C12H14Br2F2O2 and a molecular weight of 388.05 g/mol. Its IUPAC name is 1-bromo-2-(1-bromo-2,2-difluoroethyl)-4,5-diethoxybenzene.
| Compound Name | 1-bromo-2-(1-bromo-2,2-difluoroethyl)-4,5-diethoxybenzene |
|---|---|
| PubChem CID | 103514520 |
| Molecular Formula | C12H14Br2F2O2 |
| Molecular Weight | 388.05 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | 1-bromo-2-(1-bromo-2,2-difluoroethyl)-4,5-diethoxybenzene |
| SMILES | CCOc1cc(Br)c(C(Br)C(F)F)cc1OCC |
| InChI | InChI=1S/C12H14Br2F2O2/c1-3-17-9-5-7(11(14)12(15)16)8(13)6-10(9)18-4-2/h5-6,11-12H,3-4H2,1-2H3 |
| InChIKey | YPCXTLGSHZEBQM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.05 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|