C15H16Br2O2S — CID 63441143
3-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]thiophene (PubChem CID 63441143) has the molecular formula C15H16Br2O2S and a molecular weight of 420.17 g/mol. Its IUPAC name is 3-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]thiophene.
| Compound Name | 3-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 63441143 |
| Molecular Formula | C15H16Br2O2S |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 417.92 |
| IUPAC Name | 3-[bromo-(2-bromo-4,5-diethoxyphenyl)methyl]thiophene |
| SMILES | CCOc1cc(Br)c(C(Br)c2ccsc2)cc1OCC |
| InChI | InChI=1S/C15H16Br2O2S/c1-3-18-13-7-11(12(16)8-14(13)19-4-2)15(17)10-5-6-20-9-10/h5-9,15H,3-4H2,1-2H3 |
| InChIKey | BXPFSXUVTNRABD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|