C10H12BrIO2 — CID 81479058
1-bromo-4,5-diethoxy-2-iodobenzene (PubChem CID 81479058) has the molecular formula C10H12BrIO2 and a molecular weight of 371.01 g/mol. Its IUPAC name is 1-bromo-4,5-diethoxy-2-iodobenzene.
| Compound Name | 1-bromo-4,5-diethoxy-2-iodobenzene |
|---|---|
| PubChem CID | 81479058 |
| Molecular Formula | C10H12BrIO2 |
| Molecular Weight | 371.01 g/mol |
| Exact Mass | 369.91 |
| IUPAC Name | 1-bromo-4,5-diethoxy-2-iodobenzene |
| SMILES | CCOc1cc(Br)c(I)cc1OCC |
| InChI | InChI=1S/C10H12BrIO2/c1-3-13-9-5-7(11)8(12)6-10(9)14-4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | PHHRIXBVJONGCC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.01 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|