C8H7BrF2O2 — CID 84707726
6-bromo-4-ethoxy-2,3-difluorophenol (PubChem CID 84707726) has the molecular formula C8H7BrF2O2 and a molecular weight of 253.04 g/mol. Its IUPAC name is 6-bromo-4-ethoxy-2,3-difluorophenol.
| Compound Name | 6-bromo-4-ethoxy-2,3-difluorophenol |
|---|---|
| PubChem CID | 84707726 |
| Molecular Formula | C8H7BrF2O2 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 6-bromo-4-ethoxy-2,3-difluorophenol |
| SMILES | CCOc1cc(Br)c(O)c(F)c1F |
| InChI | InChI=1S/C8H7BrF2O2/c1-2-13-5-3-4(9)8(12)7(11)6(5)10/h3,12H,2H2,1H3 |
| InChIKey | KMQYXKVHTVMKNN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|