C8H6Br2F2O — CID 118813468
2,3-dibromo-1-ethoxy-4,5-difluorobenzene (PubChem CID 118813468) has the molecular formula C8H6Br2F2O and a molecular weight of 315.94 g/mol. Its IUPAC name is 2,3-dibromo-1-ethoxy-4,5-difluorobenzene.
| Compound Name | 2,3-dibromo-1-ethoxy-4,5-difluorobenzene |
|---|---|
| PubChem CID | 118813468 |
| Molecular Formula | C8H6Br2F2O |
| Molecular Weight | 315.94 g/mol |
| Exact Mass | 313.88 |
| IUPAC Name | 2,3-dibromo-1-ethoxy-4,5-difluorobenzene |
| SMILES | CCOc1cc(F)c(F)c(Br)c1Br |
| InChI | InChI=1S/C8H6Br2F2O/c1-2-13-5-3-4(11)8(12)7(10)6(5)9/h3H,2H2,1H3 |
| InChIKey | NUIFPYFICYLYLR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.94 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|