C10H12F2O2 — CID 58718970
1,4-diethoxy-2,5-difluorobenzene (PubChem CID 58718970) has the molecular formula C10H12F2O2 and a molecular weight of 202.20 g/mol. Its IUPAC name is 1,4-diethoxy-2,5-difluorobenzene.
| Compound Name | 1,4-diethoxy-2,5-difluorobenzene |
|---|---|
| PubChem CID | 58718970 |
| Molecular Formula | C10H12F2O2 |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1,4-diethoxy-2,5-difluorobenzene |
| SMILES | CCOc1cc(F)c(OCC)cc1F |
| InChI | InChI=1S/C10H12F2O2/c1-3-13-9-5-8(12)10(14-4-2)6-7(9)11/h5-6H,3-4H2,1-2H3 |
| InChIKey | ZGDZMEWKZHVIDL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |