C9H10F2O — CID 58718803
1-ethoxy-2,5-difluoro-4-methylbenzene (PubChem CID 58718803) has the molecular formula C9H10F2O and a molecular weight of 172.17 g/mol. Its IUPAC name is 1-ethoxy-2,5-difluoro-4-methylbenzene.
| Compound Name | 1-ethoxy-2,5-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 58718803 |
| Molecular Formula | C9H10F2O |
| Molecular Weight | 172.17 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-ethoxy-2,5-difluoro-4-methylbenzene |
| SMILES | CCOc1cc(F)c(C)cc1F |
| InChI | InChI=1S/C9H10F2O/c1-3-12-9-5-7(10)6(2)4-8(9)11/h4-5H,3H2,1-2H3 |
| InChIKey | IXZRYFYUZNFUFR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |