C10H13FO — CID 59933400
1-ethoxy-3-fluoro-2,5-dimethylbenzene (PubChem CID 59933400) has the molecular formula C10H13FO and a molecular weight of 168.21 g/mol. Its IUPAC name is 1-ethoxy-3-fluoro-2,5-dimethylbenzene.
| Compound Name | 1-ethoxy-3-fluoro-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 59933400 |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1-ethoxy-3-fluoro-2,5-dimethylbenzene |
| SMILES | CCOc1cc(C)cc(F)c1C |
| InChI | InChI=1S/C10H13FO/c1-4-12-10-6-7(2)5-9(11)8(10)3/h5-6H,4H2,1-3H3 |
| InChIKey | BQKVTUPLSXDYFS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |