About CID 144806033
CID 144806033 (PubChem CID 144806033) has the molecular formula C8H9F2O
and a molecular weight of 159.16 g/mol.
Molecular Properties
| Compound Name | CID 144806033 |
| PubChem CID | 144806033 |
| Molecular Formula | C8H9F2O |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | — |
| SMILES | Cc1cc(F)c(C)c(F)c1.[OH] |
| InChI | InChI=1S/C8H8F2.HO/c1-5-3-7(9)6(2)8(10)4-5;/h3-4H,1-2H3;1H |
| InChIKey | NDTIVUWCAQDNLH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 30.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 144806033 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 144806033?
The IUPAC name of CID 144806033 (CID 144806033) is not available.
What is the SMILES notation for CID 144806033?
The canonical SMILES for CID 144806033 is Cc1cc(F)c(C)c(F)c1.[OH].
What is the InChIKey of CID 144806033?
The InChIKey is NDTIVUWCAQDNLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2.HO/c1-5-3-7(9)6(2)8(10)4-5;/h3-4H,1-2H3;1H.
What are the key properties of CID 144806033?
CID 144806033 has a molecular weight of 159.16 g/mol, XLogP of 2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 144806033 is sourced from PubChem (CID 144806033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).