C7H6F2ORf — CID 59884291
2,6-difluoro-4-methylphenol;rutherfordium (PubChem CID 59884291) has the molecular formula C7H6F2ORf and a molecular weight of 411.12 g/mol. Its IUPAC name is 2,6-difluoro-4-methylphenol;rutherfordium.
| Compound Name | 2,6-difluoro-4-methylphenol;rutherfordium |
|---|---|
| PubChem CID | 59884291 |
| Molecular Formula | C7H6F2ORf |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2,6-difluoro-4-methylphenol;rutherfordium |
| SMILES | Cc1cc(F)c(O)c(F)c1.[Rf] |
| InChI | InChI=1S/C7H6F2O.Rf/c1-4-2-5(8)7(10)6(9)3-4;/h2-3,10H,1H3; |
| InChIKey | NJUSRQCEZQAJBK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |