C8H5F2O2- — CID 86307703
2,6-difluoro-4-methylbenzoate (PubChem CID 86307703) has the molecular formula C8H5F2O2- and a molecular weight of 171.12 g/mol. Its IUPAC name is 2,6-difluoro-4-methylbenzoate.
| Compound Name | 2,6-difluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 86307703 |
| Molecular Formula | C8H5F2O2- |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 2,6-difluoro-4-methylbenzoate |
| SMILES | Cc1cc(F)c(C(=O)[O-])c(F)c1 |
| InChI | InChI=1S/C8H6F2O2/c1-4-2-5(9)7(8(11)12)6(10)3-4/h2-3H,1H3,(H,11,12)/p-1 |
| InChIKey | NSHGGEJETYWOKY-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |