C11H13FO — CID 106880723
1-(2-fluoro-4,6-dimethylphenyl)propan-1-one (PubChem CID 106880723) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)propan-1-one.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 106880723 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)propan-1-one |
| SMILES | CCC(=O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C11H13FO/c1-4-10(13)11-8(3)5-7(2)6-9(11)12/h5-6H,4H2,1-3H3 |
| InChIKey | RZIPRYQAKJEALB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |