C13H18FNO2 — CID 106883090
1-(2-fluoro-4,6-dimethylphenyl)-2-(2-methoxyethylamino)ethanone (PubChem CID 106883090) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 106883090 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C13H18FNO2/c1-9-6-10(2)13(11(14)7-9)12(16)8-15-4-5-17-3/h6-7,15H,4-5,8H2,1-3H3 |
| InChIKey | KQSDGTZJCINJFK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|