C13H19NO3 — CID 110764934
2-methoxy-N-(2-methoxyethyl)-4,6-dimethylbenzamide (PubChem CID 110764934) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-methoxy-N-(2-methoxyethyl)-4,6-dimethylbenzamide.
| Compound Name | 2-methoxy-N-(2-methoxyethyl)-4,6-dimethylbenzamide |
|---|---|
| PubChem CID | 110764934 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-methoxy-N-(2-methoxyethyl)-4,6-dimethylbenzamide |
| SMILES | COCCNC(=O)c1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C13H19NO3/c1-9-7-10(2)12(11(8-9)17-4)13(15)14-5-6-16-3/h7-8H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | USKPXPIQVQXQIB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|