C23H30N2O2 — CID 132917401
2,4,6-trimethyl-N-[3-[(2,4,6-trimethylbenzoyl)amino]propyl]benzamide (PubChem CID 132917401) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[3-[(2,4,6-trimethylbenzoyl)amino]propyl]benzamide.
| Compound Name | 2,4,6-trimethyl-N-[3-[(2,4,6-trimethylbenzoyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 132917401 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2,4,6-trimethyl-N-[3-[(2,4,6-trimethylbenzoyl)amino]propyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NCCCNC(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H30N2O2/c1-14-10-16(3)20(17(4)11-14)22(26)24-8-7-9-25-23(27)21-18(5)12-15(2)13-19(21)6/h10-13H,7-9H2,1-6H3,(H,24,26)(H,25,27) |
| InChIKey | YCTZPFISACZYTE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|