C24H33N3O2 — CID 91612182
2,4,6-trimethyl-N-[2-[2-[(2,4,6-trimethylbenzoyl)amino]ethylamino]ethyl]benzamide (PubChem CID 91612182) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[2-[2-[(2,4,6-trimethylbenzoyl)amino]ethylamino]ethyl]benzamide.
| Compound Name | 2,4,6-trimethyl-N-[2-[2-[(2,4,6-trimethylbenzoyl)amino]ethylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 91612182 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2,4,6-trimethyl-N-[2-[2-[(2,4,6-trimethylbenzoyl)amino]ethylamino]ethyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)NCCNCCNC(=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H33N3O2/c1-15-11-17(3)21(18(4)12-15)23(28)26-9-7-25-8-10-27-24(29)22-19(5)13-16(2)14-20(22)6/h11-14,25H,7-10H2,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | JVVVXPNIYWFHSV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|