C10H15FO — CID 142108626
ethane;3-fluoro-2,5-dimethylphenol (PubChem CID 142108626) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is ethane;3-fluoro-2,5-dimethylphenol.
| Compound Name | ethane;3-fluoro-2,5-dimethylphenol |
|---|---|
| PubChem CID | 142108626 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;3-fluoro-2,5-dimethylphenol |
| SMILES | CC.Cc1cc(O)c(C)c(F)c1 |
| InChI | InChI=1S/C8H9FO.C2H6/c1-5-3-7(9)6(2)8(10)4-5;1-2/h3-4,10H,1-2H3;1-2H3 |
| InChIKey | SJQCNDKHPXUKFD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |