C9H11BrO — CID 130953581
3-(bromomethyl)-2,5-dimethylphenol (PubChem CID 130953581) has the molecular formula C9H11BrO and a molecular weight of 215.09 g/mol. Its IUPAC name is 3-(bromomethyl)-2,5-dimethylphenol.
| Compound Name | 3-(bromomethyl)-2,5-dimethylphenol |
|---|---|
| PubChem CID | 130953581 |
| Molecular Formula | C9H11BrO |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 3-(bromomethyl)-2,5-dimethylphenol |
| SMILES | Cc1cc(O)c(C)c(CBr)c1 |
| InChI | InChI=1S/C9H11BrO/c1-6-3-8(5-10)7(2)9(11)4-6/h3-4,11H,5H2,1-2H3 |
| InChIKey | XMLAQQKYEDDJMQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|