C8H7BrCl2 — CID 130982496
1-(bromomethyl)-2,3-dichloro-5-methylbenzene (PubChem CID 130982496) has the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. Its IUPAC name is 1-(bromomethyl)-2,3-dichloro-5-methylbenzene.
| Compound Name | 1-(bromomethyl)-2,3-dichloro-5-methylbenzene |
|---|---|
| PubChem CID | 130982496 |
| Molecular Formula | C8H7BrCl2 |
| Molecular Weight | 253.95 g/mol |
| Exact Mass | 251.91 |
| IUPAC Name | 1-(bromomethyl)-2,3-dichloro-5-methylbenzene |
| SMILES | Cc1cc(Cl)c(Cl)c(CBr)c1 |
| InChI | InChI=1S/C8H7BrCl2/c1-5-2-6(4-9)8(11)7(10)3-5/h2-3H,4H2,1H3 |
| InChIKey | DLFZUSZWEMGETH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.95 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|