C7H7F3O2 — CID 145053745
methanol;2,4,6-trifluorophenol (PubChem CID 145053745) has the molecular formula C7H7F3O2 and a molecular weight of 180.12 g/mol. Its IUPAC name is methanol;2,4,6-trifluorophenol.
| Compound Name | methanol;2,4,6-trifluorophenol |
|---|---|
| PubChem CID | 145053745 |
| Molecular Formula | C7H7F3O2 |
| Molecular Weight | 180.12 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | methanol;2,4,6-trifluorophenol |
| SMILES | CO.Oc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C6H3F3O.CH4O/c7-3-1-4(8)6(10)5(9)2-3;1-2/h1-2,10H;2H,1H3 |
| InChIKey | PEPAQGLTJBZAGS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.12 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |