C6H3F3O — CID 2733311
2,3,5-trifluorophenol (PubChem CID 2733311) has the molecular formula C6H3F3O and a molecular weight of 148.08 g/mol. Its IUPAC name is 2,3,5-trifluorophenol.
| Compound Name | 2,3,5-trifluorophenol |
|---|---|
| PubChem CID | 2733311 |
| Molecular Formula | C6H3F3O |
| Molecular Weight | 148.08 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | 2,3,5-trifluorophenol |
| SMILES | Oc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C6H3F3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| InChIKey | JNZQXSIWHRRMNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.08 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|