About 2,3,5-trifluorophenol
2,3,5-trifluorophenol (PubChem CID 2733311) has the molecular formula C6H3F3O
and a molecular weight of 148.08 g/mol. Its IUPAC name is 2,3,5-trifluorophenol.
Molecular Properties
| Compound Name | 2,3,5-trifluorophenol |
| PubChem CID | 2733311 |
| Molecular Formula | C6H3F3O |
| Molecular Weight | 148.08 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | 2,3,5-trifluorophenol |
| SMILES | Oc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C6H3F3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
| InChIKey | JNZQXSIWHRRMNO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.08 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trifluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trifluorophenol?
The IUPAC name of 2,3,5-trifluorophenol (CID 2733311) is 2,3,5-trifluorophenol.
What is the SMILES notation for 2,3,5-trifluorophenol?
The canonical SMILES for 2,3,5-trifluorophenol is Oc1cc(F)cc(F)c1F.
What is the InChIKey of 2,3,5-trifluorophenol?
The InChIKey is JNZQXSIWHRRMNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H.
What are the key properties of 2,3,5-trifluorophenol?
2,3,5-trifluorophenol has a molecular weight of 148.08 g/mol, XLogP of 1.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trifluorophenol is sourced from PubChem (CID 2733311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).