About 3-chloro-2,5-difluorophenol
3-chloro-2,5-difluorophenol (PubChem CID 84651989) has the molecular formula C6H3ClF2O
and a molecular weight of 164.54 g/mol. Its IUPAC name is 3-chloro-2,5-difluorophenol.
Molecular Properties
| Compound Name | 3-chloro-2,5-difluorophenol |
| PubChem CID | 84651989 |
| Molecular Formula | C6H3ClF2O |
| Molecular Weight | 164.54 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | 3-chloro-2,5-difluorophenol |
| SMILES | Oc1cc(F)cc(Cl)c1F |
| InChI | InChI=1S/C6H3ClF2O/c7-4-1-3(8)2-5(10)6(4)9/h1-2,10H |
| InChIKey | VXANUDYEFDJAGG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,5-difluorophenol?
The IUPAC name of 3-chloro-2,5-difluorophenol (CID 84651989) is 3-chloro-2,5-difluorophenol.
What is the SMILES notation for 3-chloro-2,5-difluorophenol?
The canonical SMILES for 3-chloro-2,5-difluorophenol is Oc1cc(F)cc(Cl)c1F.
What is the InChIKey of 3-chloro-2,5-difluorophenol?
The InChIKey is VXANUDYEFDJAGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClF2O/c7-4-1-3(8)2-5(10)6(4)9/h1-2,10H.
What are the key properties of 3-chloro-2,5-difluorophenol?
3-chloro-2,5-difluorophenol has a molecular weight of 164.54 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,5-difluorophenol is sourced from PubChem (CID 84651989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).