C6H2Cl3FO — CID 142663358
2,3,5-trichloro-4-fluorophenol (PubChem CID 142663358) has the molecular formula C6H2Cl3FO and a molecular weight of 215.44 g/mol. Its IUPAC name is 2,3,5-trichloro-4-fluorophenol.
| Compound Name | 2,3,5-trichloro-4-fluorophenol |
|---|---|
| PubChem CID | 142663358 |
| Molecular Formula | C6H2Cl3FO |
| Molecular Weight | 215.44 g/mol |
| Exact Mass | 213.92 |
| IUPAC Name | 2,3,5-trichloro-4-fluorophenol |
| SMILES | Oc1cc(Cl)c(F)c(Cl)c1Cl |
| InChI | InChI=1S/C6H2Cl3FO/c7-2-1-3(11)4(8)5(9)6(2)10/h1,11H |
| InChIKey | LXECTTCBDIIABN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|