C6H4ClFO2 — CID 45119169
2-chloro-5-fluorobenzene-1,4-diol (PubChem CID 45119169) has the molecular formula C6H4ClFO2 and a molecular weight of 162.55 g/mol. Its IUPAC name is 2-chloro-5-fluorobenzene-1,4-diol.
| Compound Name | 2-chloro-5-fluorobenzene-1,4-diol |
|---|---|
| PubChem CID | 45119169 |
| Molecular Formula | C6H4ClFO2 |
| Molecular Weight | 162.55 g/mol |
| Exact Mass | 161.99 |
| IUPAC Name | 2-chloro-5-fluorobenzene-1,4-diol |
| SMILES | Oc1cc(Cl)c(O)cc1F |
| InChI | InChI=1S/C6H4ClFO2/c7-3-1-6(10)4(8)2-5(3)9/h1-2,9-10H |
| InChIKey | ZWHSFZYTWFNBSA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|