C6H3Cl2FO — CID 3535760
2,5-dichloro-4-fluorophenol (PubChem CID 3535760) has the molecular formula C6H3Cl2FO and a molecular weight of 180.99 g/mol. Its IUPAC name is 2,5-dichloro-4-fluorophenol.
| Compound Name | 2,5-dichloro-4-fluorophenol |
|---|---|
| PubChem CID | 3535760 |
| Molecular Formula | C6H3Cl2FO |
| Molecular Weight | 180.99 g/mol |
| Exact Mass | 179.95 |
| IUPAC Name | 2,5-dichloro-4-fluorophenol |
| SMILES | Oc1cc(Cl)c(F)cc1Cl |
| InChI | InChI=1S/C6H3Cl2FO/c7-3-2-6(10)4(8)1-5(3)9/h1-2,10H |
| InChIKey | AAFZAYHKWLNAMC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.99 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|