C12H3Cl3F4O2 — CID 57289422
2,4,5-trichloro-3-(2,3,5,6-tetrafluorophenoxy)phenol (PubChem CID 57289422) has the molecular formula C12H3Cl3F4O2 and a molecular weight of 361.51 g/mol. Its IUPAC name is 2,4,5-trichloro-3-(2,3,5,6-tetrafluorophenoxy)phenol.
| Compound Name | 2,4,5-trichloro-3-(2,3,5,6-tetrafluorophenoxy)phenol |
|---|---|
| PubChem CID | 57289422 |
| Molecular Formula | C12H3Cl3F4O2 |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 359.91 |
| IUPAC Name | 2,4,5-trichloro-3-(2,3,5,6-tetrafluorophenoxy)phenol |
| SMILES | Oc1cc(Cl)c(Cl)c(Oc2c(F)c(F)cc(F)c2F)c1Cl |
| InChI | InChI=1S/C12H3Cl3F4O2/c13-3-1-6(20)8(15)11(7(3)14)21-12-9(18)4(16)2-5(17)10(12)19/h1-2,20H |
| InChIKey | YRCPIBUJKGWAPI-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|