C12H7F4NO — CID 102133014
4-(2,3,5,6-tetrafluorophenoxy)aniline (PubChem CID 102133014) has the molecular formula C12H7F4NO and a molecular weight of 257.19 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrafluorophenoxy)aniline.
| Compound Name | 4-(2,3,5,6-tetrafluorophenoxy)aniline |
|---|---|
| PubChem CID | 102133014 |
| Molecular Formula | C12H7F4NO |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(2,3,5,6-tetrafluorophenoxy)aniline |
| SMILES | Nc1ccc(Oc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C12H7F4NO/c13-8-5-9(14)11(16)12(10(8)15)18-7-3-1-6(17)2-4-7/h1-5H,17H2 |
| InChIKey | GZCOILZIPRLULL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|