C16H20N2O — CID 15937172
4-(4-aminophenoxy)-2,3,5,6-tetramethylaniline (PubChem CID 15937172) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-2,3,5,6-tetramethylaniline.
| Compound Name | 4-(4-aminophenoxy)-2,3,5,6-tetramethylaniline |
|---|---|
| PubChem CID | 15937172 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(4-aminophenoxy)-2,3,5,6-tetramethylaniline |
| SMILES | Cc1c(C)c(Oc2ccc(N)cc2)c(C)c(C)c1N |
| InChI | InChI=1S/C16H20N2O/c1-9-11(3)16(12(4)10(2)15(9)18)19-14-7-5-13(17)6-8-14/h5-8H,17-18H2,1-4H3 |
| InChIKey | VGQUYGKAFGKINO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|