C20H20N2O2 — CID 139877807
4-[3-(4-aminophenoxy)-2,5-dimethylphenoxy]aniline (PubChem CID 139877807) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 4-[3-(4-aminophenoxy)-2,5-dimethylphenoxy]aniline.
| Compound Name | 4-[3-(4-aminophenoxy)-2,5-dimethylphenoxy]aniline |
|---|---|
| PubChem CID | 139877807 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-[3-(4-aminophenoxy)-2,5-dimethylphenoxy]aniline |
| SMILES | Cc1cc(Oc2ccc(N)cc2)c(C)c(Oc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C20H20N2O2/c1-13-11-19(23-17-7-3-15(21)4-8-17)14(2)20(12-13)24-18-9-5-16(22)6-10-18/h3-12H,21-22H2,1-2H3 |
| InChIKey | PKLYTSZYAMELII-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|