C16H20N2O — CID 144504905
4-[4-(2-aminoethyl)-2,6-dimethylphenoxy]aniline (PubChem CID 144504905) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)-2,6-dimethylphenoxy]aniline.
| Compound Name | 4-[4-(2-aminoethyl)-2,6-dimethylphenoxy]aniline |
|---|---|
| PubChem CID | 144504905 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-[4-(2-aminoethyl)-2,6-dimethylphenoxy]aniline |
| SMILES | Cc1cc(CCN)cc(C)c1Oc1ccc(N)cc1 |
| InChI | InChI=1S/C16H20N2O/c1-11-9-13(7-8-17)10-12(2)16(11)19-15-5-3-14(18)4-6-15/h3-6,9-10H,7-8,17-18H2,1-2H3 |
| InChIKey | HAAXJBYSDWBQMF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|