C21H33NO — CID 144504819
3-(3,5-dimethyl-4-phenoxyphenyl)propan-1-amine;ethane (PubChem CID 144504819) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-phenoxyphenyl)propan-1-amine;ethane.
| Compound Name | 3-(3,5-dimethyl-4-phenoxyphenyl)propan-1-amine;ethane |
|---|---|
| PubChem CID | 144504819 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 3-(3,5-dimethyl-4-phenoxyphenyl)propan-1-amine;ethane |
| SMILES | CC.CC.Cc1cc(CCCN)cc(C)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H21NO.2C2H6/c1-13-11-15(7-6-10-18)12-14(2)17(13)19-16-8-4-3-5-9-16;2*1-2/h3-5,8-9,11-12H,6-7,10,18H2,1-2H3;2*1-2H3 |
| InChIKey | CFRFSDDFKLQRSM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |