About ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine
ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine (PubChem CID 144504897) has the molecular formula C27H39NO3S
and a molecular weight of 457.68 g/mol. Its IUPAC name is ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine.
Molecular Properties
| Compound Name | ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine |
| PubChem CID | 144504897 |
| Molecular Formula | C27H39NO3S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine |
| SMILES | CC.CC.Cc1cc(CCCO)cc(C)c1Oc1ccc(O)cc1.NSc1ccccc1 |
| InChI | InChI=1S/C17H20O3.C6H7NS.2C2H6/c1-12-10-14(4-3-9-18)11-13(2)17(12)20-16-7-5-15(19)6-8-16;7-8-6-4-2-1-3-5-6;2*1-2/h5-8,10-11,18-19H,3-4,9H2,1-2H3;1-5H,7H2;2*1-2H3 |
| InChIKey | BZZAXQSNEXXRPE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine?
The IUPAC name of ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine (CID 144504897) is ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine.
What is the SMILES notation for ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine?
The canonical SMILES for ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine is CC.CC.Cc1cc(CCCO)cc(C)c1Oc1ccc(O)cc1.NSc1ccccc1.
What is the InChIKey of ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine?
The InChIKey is BZZAXQSNEXXRPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3.C6H7NS.2C2H6/c1-12-10-14(4-3-9-18)11-13(2)17(12)20-16-7-5-15(19)6-8-16;7-8-6-4-2-1-3-5-6;2*1-2/h5-8,10-11,18-19H,3-4,9H2,1-2H3;1-5H,7H2;2*1-2H3.
What are the key properties of ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine?
ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine has a molecular weight of 457.68 g/mol, XLogP of 7.43, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-[4-(3-hydroxypropyl)-2,6-dimethylphenoxy]phenol;S-phenylthiohydroxylamine is sourced from PubChem (CID 144504897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).