C20H27NO3 — CID 144504805
ethane;N-ethyl-2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetamide (PubChem CID 144504805) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethane;N-ethyl-2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetamide.
| Compound Name | ethane;N-ethyl-2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 144504805 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | ethane;N-ethyl-2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetamide |
| SMILES | CC.CCNC(=O)Cc1cc(C)c(Oc2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO3.C2H6/c1-4-19-17(21)11-14-9-12(2)18(13(3)10-14)22-16-7-5-15(20)6-8-16;1-2/h5-10,20H,4,11H2,1-3H3,(H,19,21);1-2H3 |
| InChIKey | ANJGKCSTNHYHHN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |