C28H44N2O4 — CID 144504755
ethane;N-[3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]propyl]-3-morpholin-4-ylpropanamide (PubChem CID 144504755) has the molecular formula C28H44N2O4 and a molecular weight of 472.67 g/mol. Its IUPAC name is ethane;N-[3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]propyl]-3-morpholin-4-ylpropanamide.
| Compound Name | ethane;N-[3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]propyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 144504755 |
| Molecular Formula | C28H44N2O4 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.33 |
| IUPAC Name | ethane;N-[3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]propyl]-3-morpholin-4-ylpropanamide |
| SMILES | CC.CC.Cc1cc(CCCNC(=O)CCN2CCOCC2)cc(C)c1Oc1ccc(O)cc1 |
| InChI | InChI=1S/C24H32N2O4.2C2H6/c1-18-16-20(17-19(2)24(18)30-22-7-5-21(27)6-8-22)4-3-10-25-23(28)9-11-26-12-14-29-15-13-26;2*1-2/h5-8,16-17,27H,3-4,9-15H2,1-2H3,(H,25,28);2*1-2H3 |
| InChIKey | UVGKMPKSWGHEEP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|