C22H33NO3S — CID 144504663
ethane;3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]-N-methylsulfanylpropanamide (PubChem CID 144504663) has the molecular formula C22H33NO3S and a molecular weight of 391.58 g/mol. Its IUPAC name is ethane;3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]-N-methylsulfanylpropanamide.
| Compound Name | ethane;3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]-N-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 144504663 |
| Molecular Formula | C22H33NO3S |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | ethane;3-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]-N-methylsulfanylpropanamide |
| SMILES | CC.CC.CSNC(=O)CCc1cc(C)c(Oc2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C18H21NO3S.2C2H6/c1-12-10-14(4-9-17(21)19-23-3)11-13(2)18(12)22-16-7-5-15(20)6-8-16;2*1-2/h5-8,10-11,20H,4,9H2,1-3H3,(H,19,21);2*1-2H3 |
| InChIKey | XQSAXWHHJMBZEZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|