C24H34N2O4 — CID 144504784
ethane;4-[2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetyl]piperazin-2-one (PubChem CID 144504784) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is ethane;4-[2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetyl]piperazin-2-one.
| Compound Name | ethane;4-[2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 144504784 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | ethane;4-[2-[4-(4-hydroxyphenoxy)-3,5-dimethylphenyl]acetyl]piperazin-2-one |
| SMILES | CC.CC.Cc1cc(CC(=O)N2CCNC(=O)C2)cc(C)c1Oc1ccc(O)cc1 |
| InChI | InChI=1S/C20H22N2O4.2C2H6/c1-13-9-15(11-19(25)22-8-7-21-18(24)12-22)10-14(2)20(13)26-17-5-3-16(23)4-6-17;2*1-2/h3-6,9-10,23H,7-8,11-12H2,1-2H3,(H,21,24);2*1-2H3 |
| InChIKey | KNLMROOQYGOQDN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |