C20H21ClN4O6 — CID 129256556
N-[3-chloro-4-[4-hydroxy-3-[(3-oxopiperazin-1-yl)methyl]phenoxy]-5-methylphenyl]-N'-hydroxyoxamide (PubChem CID 129256556) has the molecular formula C20H21ClN4O6 and a molecular weight of 448.86 g/mol. Its IUPAC name is N-[3-chloro-4-[4-hydroxy-3-[(3-oxopiperazin-1-yl)methyl]phenoxy]-5-methylphenyl]-N'-hydroxyoxamide.
| Compound Name | N-[3-chloro-4-[4-hydroxy-3-[(3-oxopiperazin-1-yl)methyl]phenoxy]-5-methylphenyl]-N'-hydroxyoxamide |
|---|---|
| PubChem CID | 129256556 |
| Molecular Formula | C20H21ClN4O6 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[3-chloro-4-[4-hydroxy-3-[(3-oxopiperazin-1-yl)methyl]phenoxy]-5-methylphenyl]-N'-hydroxyoxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NO)cc(Cl)c1Oc1ccc(O)c(CN2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C20H21ClN4O6/c1-11-6-13(23-19(28)20(29)24-30)8-15(21)18(11)31-14-2-3-16(26)12(7-14)9-25-5-4-22-17(27)10-25/h2-3,6-8,26,30H,4-5,9-10H2,1H3,(H,22,27)(H,23,28)(H,24,29) |
| InChIKey | YDZMMKNENZPSGC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 140.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|