C19H19ClN2O6 — CID 18614082
2-[3-chloro-4-[3-[ethyl(methyl)carbamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid (PubChem CID 18614082) has the molecular formula C19H19ClN2O6 and a molecular weight of 406.82 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-[ethyl(methyl)carbamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4-[3-[ethyl(methyl)carbamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614082 |
| Molecular Formula | C19H19ClN2O6 |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-[3-chloro-4-[3-[ethyl(methyl)carbamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid |
| SMILES | CCN(C)C(=O)c1cc(Oc2c(C)cc(NC(=O)C(=O)O)cc2Cl)ccc1O |
| InChI | InChI=1S/C19H19ClN2O6/c1-4-22(3)18(25)13-9-12(5-6-15(13)23)28-16-10(2)7-11(8-14(16)20)21-17(24)19(26)27/h5-9,23H,4H2,1-3H3,(H,21,24)(H,26,27) |
| InChIKey | IEUGMMDXKUMEGQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|