C22H18ClNO6 — CID 18614172
2-[3-chloro-4-[4-hydroxy-3-(phenoxymethyl)phenoxy]-5-methylanilino]-2-oxoacetic acid (PubChem CID 18614172) has the molecular formula C22H18ClNO6 and a molecular weight of 427.84 g/mol. Its IUPAC name is 2-[3-chloro-4-[4-hydroxy-3-(phenoxymethyl)phenoxy]-5-methylanilino]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4-[4-hydroxy-3-(phenoxymethyl)phenoxy]-5-methylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614172 |
| Molecular Formula | C22H18ClNO6 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 2-[3-chloro-4-[4-hydroxy-3-(phenoxymethyl)phenoxy]-5-methylanilino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)cc(Cl)c1Oc1ccc(O)c(COc2ccccc2)c1 |
| InChI | InChI=1S/C22H18ClNO6/c1-13-9-15(24-21(26)22(27)28)11-18(23)20(13)30-17-7-8-19(25)14(10-17)12-29-16-5-3-2-4-6-16/h2-11,25H,12H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | OEZSGCVBSMPIBW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|