C19H18ClNO5 — CID 18614115
2-[3-chloro-4-[(4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-5-methylanilino]-2-oxoacetic acid (PubChem CID 18614115) has the molecular formula C19H18ClNO5 and a molecular weight of 375.81 g/mol. Its IUPAC name is 2-[3-chloro-4-[(4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-5-methylanilino]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4-[(4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-5-methylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614115 |
| Molecular Formula | C19H18ClNO5 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[3-chloro-4-[(4-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]-5-methylanilino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)cc(Cl)c1Oc1ccc(O)c2c1CCCC2 |
| InChI | InChI=1S/C19H18ClNO5/c1-10-8-11(21-18(23)19(24)25)9-14(20)17(10)26-16-7-6-15(22)12-4-2-3-5-13(12)16/h6-9,22H,2-5H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | GGGVXTPQMDSBBA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|