C18H16Cl2N2O7S — CID 18614233
2-[3,5-dichloro-4-[3-(cyclobutylsulfamoyl)-4-hydroxyphenoxy]anilino]-2-oxoacetic acid (PubChem CID 18614233) has the molecular formula C18H16Cl2N2O7S and a molecular weight of 475.31 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[3-(cyclobutylsulfamoyl)-4-hydroxyphenoxy]anilino]-2-oxoacetic acid.
| Compound Name | 2-[3,5-dichloro-4-[3-(cyclobutylsulfamoyl)-4-hydroxyphenoxy]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614233 |
| Molecular Formula | C18H16Cl2N2O7S |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.01 |
| IUPAC Name | 2-[3,5-dichloro-4-[3-(cyclobutylsulfamoyl)-4-hydroxyphenoxy]anilino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)NC3CCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O7S/c19-12-6-10(21-17(24)18(25)26)7-13(20)16(12)29-11-4-5-14(23)15(8-11)30(27,28)22-9-2-1-3-9/h4-9,22-23H,1-3H2,(H,21,24)(H,25,26) |
| InChIKey | PSLKFNNJVMTHHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|