C20H22Cl2N2O7S — CID 142657581
methyl 3-[4-[3-(butylsulfamoyl)-4-hydroxyphenoxy]-3,5-dichloroanilino]-3-oxopropanoate (PubChem CID 142657581) has the molecular formula C20H22Cl2N2O7S and a molecular weight of 505.38 g/mol. Its IUPAC name is methyl 3-[4-[3-(butylsulfamoyl)-4-hydroxyphenoxy]-3,5-dichloroanilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[3-(butylsulfamoyl)-4-hydroxyphenoxy]-3,5-dichloroanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 142657581 |
| Molecular Formula | C20H22Cl2N2O7S |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | methyl 3-[4-[3-(butylsulfamoyl)-4-hydroxyphenoxy]-3,5-dichloroanilino]-3-oxopropanoate |
| SMILES | CCCCNS(=O)(=O)c1cc(Oc2c(Cl)cc(NC(=O)CC(=O)OC)cc2Cl)ccc1O |
| InChI | InChI=1S/C20H22Cl2N2O7S/c1-3-4-7-23-32(28,29)17-10-13(5-6-16(17)25)31-20-14(21)8-12(9-15(20)22)24-18(26)11-19(27)30-2/h5-6,8-10,23,25H,3-4,7,11H2,1-2H3,(H,24,26) |
| InChIKey | NMUXEWQRJOGAJU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|