About 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid
3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid (PubChem CID 69261317) has the molecular formula C21H21Cl2NO7S
and a molecular weight of 502.37 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid |
| PubChem CID | 69261317 |
| Molecular Formula | C21H21Cl2NO7S |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)CC3CCCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2NO7S/c22-15-7-13(24-19(26)10-20(27)28)8-16(23)21(15)31-14-5-6-17(25)18(9-14)32(29,30)11-12-3-1-2-4-12/h5-9,12,25H,1-4,10-11H2,(H,24,26)(H,27,28) |
| InChIKey | RYHCRWJLXNIQDU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid?
The IUPAC name of 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid (CID 69261317) is 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid.
What is the SMILES notation for 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid?
The canonical SMILES for 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid is O=C(O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)CC3CCCC3)c2)c(Cl)c1.
What is the InChIKey of 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid?
The InChIKey is RYHCRWJLXNIQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21Cl2NO7S/c22-15-7-13(24-19(26)10-20(27)28)8-16(23)21(15)31-14-5-6-17(25)18(9-14)32(29,30)11-12-3-1-2-4-12/h5-9,12,25H,1-4,10-11H2,(H,24,26)(H,27,28).
What are the key properties of 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid?
3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid has a molecular weight of 502.37 g/mol, XLogP of 4.87, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid is sourced from PubChem (CID 69261317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).