C21H21Cl2NO7S — CID 69261317
3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid (PubChem CID 69261317) has the molecular formula C21H21Cl2NO7S and a molecular weight of 502.37 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69261317 |
| Molecular Formula | C21H21Cl2NO7S |
| Molecular Weight | 502.37 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 3-[3,5-dichloro-4-[3-(cyclopentylmethylsulfonyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)CC3CCCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2NO7S/c22-15-7-13(24-19(26)10-20(27)28)8-16(23)21(15)31-14-5-6-17(25)18(9-14)32(29,30)11-12-3-1-2-4-12/h5-9,12,25H,1-4,10-11H2,(H,24,26)(H,27,28) |
| InChIKey | RYHCRWJLXNIQDU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|