C22H16Cl2FNO7S — CID 11756696
methyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate (PubChem CID 11756696) has the molecular formula C22H16Cl2FNO7S and a molecular weight of 528.34 g/mol. Its IUPAC name is methyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate.
| Compound Name | methyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 11756696 |
| Molecular Formula | C22H16Cl2FNO7S |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | methyl 3-[3,5-dichloro-4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]anilino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)c3ccc(F)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C22H16Cl2FNO7S/c1-32-21(29)11-20(28)26-13-8-16(23)22(17(24)9-13)33-14-4-7-18(27)19(10-14)34(30,31)15-5-2-12(25)3-6-15/h2-10,27H,11H2,1H3,(H,26,28) |
| InChIKey | PUFDJBDEXMXFPW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|