C28H29FN2O5S — CID 142018534
2-cyclopropylidene-2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylanilino]-N-propan-2-ylacetamide (PubChem CID 142018534) has the molecular formula C28H29FN2O5S and a molecular weight of 524.61 g/mol. Its IUPAC name is 2-cyclopropylidene-2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylanilino]-N-propan-2-ylacetamide.
| Compound Name | 2-cyclopropylidene-2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylanilino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 142018534 |
| Molecular Formula | C28H29FN2O5S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-cyclopropylidene-2-[4-[3-(4-fluorophenyl)sulfonyl-4-hydroxyphenoxy]-3,5-dimethylanilino]-N-propan-2-ylacetamide |
| SMILES | Cc1cc(NC(C(=O)NC(C)C)=C2CC2)cc(C)c1Oc1ccc(O)c(S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C28H29FN2O5S/c1-16(2)30-28(33)26(19-5-6-19)31-21-13-17(3)27(18(4)14-21)36-22-9-12-24(32)25(15-22)37(34,35)23-10-7-20(29)8-11-23/h7-16,31-32H,5-6H2,1-4H3,(H,30,33) |
| InChIKey | ZDCNVTZQSSBZTD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|